A new chiral mono-complex(S)-[Zn(FcCH2NHCH(CH2CH(CH3)2)COO)2·H2O]·3H2O has been synthesized by the reaction of(S)-FcCH2NHCH(CH2CH(CH3)2)COONa and ZnAc2.X-ray diffraction technique reveals that the central Zn2+ ion coordinates with two(S)-FcCH2NHCH(CH2CH(CH3)2)COO-and one water molecule.The crystal belongs triclinic with space group P1.The cell parameters are:a=11.1883(4) ;b=11.1934(4) ;c=30.6717(15) ;α=97.6160(10)°,β=97.6120(10)°,γ=90.157(11)°.The electrochemical properties and fluorescence properties of the title complex and the pure ligand are determined.
